C23H18O2 — CID 5388565
(2Z)-1-phenyl-2-[(4-phenylphenyl)methylidene]butane-1,3-dione (PubChem CID 5388565) has the molecular formula C23H18O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2Z)-1-phenyl-2-[(4-phenylphenyl)methylidene]butane-1,3-dione.
| Compound Name | (2Z)-1-phenyl-2-[(4-phenylphenyl)methylidene]butane-1,3-dione |
|---|---|
| PubChem CID | 5388565 |
| Molecular Formula | C23H18O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2Z)-1-phenyl-2-[(4-phenylphenyl)methylidene]butane-1,3-dione |
| SMILES | CC(=O)/C(=C/c1ccc(-c2ccccc2)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H18O2/c1-17(24)22(23(25)21-10-6-3-7-11-21)16-18-12-14-20(15-13-18)19-8-4-2-5-9-19/h2-16H,1H3/b22-16- |
| InChIKey | NPMHKEMZUVOLJB-JWGURIENSA-N |
| XLogP | 5.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|