C20H18O4 — CID 11244167
(2E,3Z)-3-(1-hydroxyethylidene)-2-[(4-hydroxyphenyl)methylidene]-1-phenylpentane-1,4-dione (PubChem CID 11244167) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2E,3Z)-3-(1-hydroxyethylidene)-2-[(4-hydroxyphenyl)methylidene]-1-phenylpentane-1,4-dione.
| Compound Name | (2E,3Z)-3-(1-hydroxyethylidene)-2-[(4-hydroxyphenyl)methylidene]-1-phenylpentane-1,4-dione |
|---|---|
| PubChem CID | 11244167 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (2E,3Z)-3-(1-hydroxyethylidene)-2-[(4-hydroxyphenyl)methylidene]-1-phenylpentane-1,4-dione |
| SMILES | CC(=O)C(=C(/C)O)/C(=C\c1ccc(O)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18O4/c1-13(21)19(14(2)22)18(12-15-8-10-17(23)11-9-15)20(24)16-6-4-3-5-7-16/h3-12,21,23H,1-2H3/b18-12+,19-13+ |
| InChIKey | QAWHYEFVKONTSS-KLCVKJMQSA-N |
| XLogP | 4.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|