C15H16O3 — CID 102207031
(3E,4Z)-3-benzylidene-4-(1-hydroxyethylidene)hexane-2,5-dione (PubChem CID 102207031) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3E,4Z)-3-benzylidene-4-(1-hydroxyethylidene)hexane-2,5-dione.
| Compound Name | (3E,4Z)-3-benzylidene-4-(1-hydroxyethylidene)hexane-2,5-dione |
|---|---|
| PubChem CID | 102207031 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (3E,4Z)-3-benzylidene-4-(1-hydroxyethylidene)hexane-2,5-dione |
| SMILES | CC(=O)C(=C(/C)O)/C(=C\c1ccccc1)C(C)=O |
| InChI | InChI=1S/C15H16O3/c1-10(16)14(15(11(2)17)12(3)18)9-13-7-5-4-6-8-13/h4-9,17H,1-3H3/b14-9-,15-11+ |
| InChIKey | NZIYRMRTFSTOBH-GNESMGCMSA-N |
| XLogP | 3.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|