C15H19NO2 — CID 2185858
(2Z)-2-benzylidene-N,N-diethyl-3-oxobutanamide (PubChem CID 2185858) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N,N-diethyl-3-oxobutanamide.
| Compound Name | (2Z)-2-benzylidene-N,N-diethyl-3-oxobutanamide |
|---|---|
| PubChem CID | 2185858 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (2Z)-2-benzylidene-N,N-diethyl-3-oxobutanamide |
| SMILES | CCN(CC)C(=O)/C(=C\c1ccccc1)C(C)=O |
| InChI | InChI=1S/C15H19NO2/c1-4-16(5-2)15(18)14(12(3)17)11-13-9-7-6-8-10-13/h6-11H,4-5H2,1-3H3/b14-11- |
| InChIKey | VNIBVBFPSPMYCH-KAMYIIQDSA-N |
| XLogP | 2.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|