C20H28O — CID 143816437
(3E)-3-benzylidene-4-methylidene-6-propylnonan-2-one (PubChem CID 143816437) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (3E)-3-benzylidene-4-methylidene-6-propylnonan-2-one.
| Compound Name | (3E)-3-benzylidene-4-methylidene-6-propylnonan-2-one |
|---|---|
| PubChem CID | 143816437 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (3E)-3-benzylidene-4-methylidene-6-propylnonan-2-one |
| SMILES | C=C(CC(CCC)CCC)/C(=C\c1ccccc1)C(C)=O |
| InChI | InChI=1S/C20H28O/c1-5-10-18(11-6-2)14-16(3)20(17(4)21)15-19-12-8-7-9-13-19/h7-9,12-13,15,18H,3,5-6,10-11,14H2,1-2,4H3/b20-15+ |
| InChIKey | QLRIMZBZFZTYLY-HMMYKYKNSA-N |
| XLogP | 5.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|