C18H27ClN2O2 — CID 54611069
4-benzylidene-1,7-bis(dimethylamino)heptane-3,5-dione;hydrochloride (PubChem CID 54611069) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 4-benzylidene-1,7-bis(dimethylamino)heptane-3,5-dione;hydrochloride.
| Compound Name | 4-benzylidene-1,7-bis(dimethylamino)heptane-3,5-dione;hydrochloride |
|---|---|
| PubChem CID | 54611069 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 4-benzylidene-1,7-bis(dimethylamino)heptane-3,5-dione;hydrochloride |
| SMILES | CN(C)CCC(=O)C(=Cc1ccccc1)C(=O)CCN(C)C.Cl |
| InChI | InChI=1S/C18H26N2O2.ClH/c1-19(2)12-10-17(21)16(18(22)11-13-20(3)4)14-15-8-6-5-7-9-15;/h5-9,14H,10-13H2,1-4H3;1H |
| InChIKey | VLGSPDFLJUNUJX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|