C19H29ClN2O2 — CID 54607722
1,7-bis(dimethylamino)-4-[(4-methylphenyl)methylidene]heptane-3,5-dione;hydrochloride (PubChem CID 54607722) has the molecular formula C19H29ClN2O2 and a molecular weight of 352.91 g/mol. Its IUPAC name is 1,7-bis(dimethylamino)-4-[(4-methylphenyl)methylidene]heptane-3,5-dione;hydrochloride.
| Compound Name | 1,7-bis(dimethylamino)-4-[(4-methylphenyl)methylidene]heptane-3,5-dione;hydrochloride |
|---|---|
| PubChem CID | 54607722 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1,7-bis(dimethylamino)-4-[(4-methylphenyl)methylidene]heptane-3,5-dione;hydrochloride |
| SMILES | Cc1ccc(C=C(C(=O)CCN(C)C)C(=O)CCN(C)C)cc1.Cl |
| InChI | InChI=1S/C19H28N2O2.ClH/c1-15-6-8-16(9-7-15)14-17(18(22)10-12-20(2)3)19(23)11-13-21(4)5;/h6-9,14H,10-13H2,1-5H3;1H |
| InChIKey | KMHCHUQXZWPFDB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|