C24H33BrN2O4 — CID 54608710
(3E)-3-[[4-[(E)-2-acetyl-5-(dimethylamino)-3-oxopent-1-enyl]phenyl]methylidene]-6-(dimethylamino)hexane-2,4-dione;hydrobromide (PubChem CID 54608710) has the molecular formula C24H33BrN2O4 and a molecular weight of 493.44 g/mol. Its IUPAC name is (3E)-3-[[4-[(E)-2-acetyl-5-(dimethylamino)-3-oxopent-1-enyl]phenyl]methylidene]-6-(dimethylamino)hexane-2,4-dione;hydrobromide.
| Compound Name | (3E)-3-[[4-[(E)-2-acetyl-5-(dimethylamino)-3-oxopent-1-enyl]phenyl]methylidene]-6-(dimethylamino)hexane-2,4-dione;hydrobromide |
|---|---|
| PubChem CID | 54608710 |
| Molecular Formula | C24H33BrN2O4 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (3E)-3-[[4-[(E)-2-acetyl-5-(dimethylamino)-3-oxopent-1-enyl]phenyl]methylidene]-6-(dimethylamino)hexane-2,4-dione;hydrobromide |
| SMILES | Br.CC(=O)/C(=C\c1ccc(/C=C(\C(C)=O)C(=O)CCN(C)C)cc1)C(=O)CCN(C)C |
| InChI | InChI=1S/C24H32N2O4.BrH/c1-17(27)21(23(29)11-13-25(3)4)15-19-7-9-20(10-8-19)16-22(18(2)28)24(30)12-14-26(5)6;/h7-10,15-16H,11-14H2,1-6H3;1H/b21-15+,22-16+; |
| InChIKey | LWIMISXJQMZFPH-HYOXNGFTSA-N |
| XLogP | 3.25 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|