C20H28O2 — CID 19104285
3-[(4-octylphenyl)methylidene]pentane-2,4-dione (PubChem CID 19104285) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 3-[(4-octylphenyl)methylidene]pentane-2,4-dione.
| Compound Name | 3-[(4-octylphenyl)methylidene]pentane-2,4-dione |
|---|---|
| PubChem CID | 19104285 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 3-[(4-octylphenyl)methylidene]pentane-2,4-dione |
| SMILES | CCCCCCCCc1ccc(C=C(C(C)=O)C(C)=O)cc1 |
| InChI | InChI=1S/C20H28O2/c1-4-5-6-7-8-9-10-18-11-13-19(14-12-18)15-20(16(2)21)17(3)22/h11-15H,4-10H2,1-3H3 |
| InChIKey | JFNMZTMRVBDZHI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|