C20H22F2 — CID 14573367
1-(2,2-difluoroethenyl)-4-(4-hexylphenyl)benzene (PubChem CID 14573367) has the molecular formula C20H22F2 and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-(2,2-difluoroethenyl)-4-(4-hexylphenyl)benzene.
| Compound Name | 1-(2,2-difluoroethenyl)-4-(4-hexylphenyl)benzene |
|---|---|
| PubChem CID | 14573367 |
| Molecular Formula | C20H22F2 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-(2,2-difluoroethenyl)-4-(4-hexylphenyl)benzene |
| SMILES | CCCCCCc1ccc(-c2ccc(C=C(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H22F2/c1-2-3-4-5-6-16-7-11-18(12-8-16)19-13-9-17(10-14-19)15-20(21)22/h7-15H,2-6H2,1H3 |
| InChIKey | QKOVDPSAJXHSGF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|