About ethane;4-pentylbenzaldehyde
ethane;4-pentylbenzaldehyde (PubChem CID 143882863) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is ethane;4-pentylbenzaldehyde.
Molecular Properties
| Compound Name | ethane;4-pentylbenzaldehyde |
| PubChem CID | 143882863 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | ethane;4-pentylbenzaldehyde |
| SMILES | CC.CCCCCc1ccc(C=O)cc1 |
| InChI | InChI=1S/C12H16O.C2H6/c1-2-3-4-5-11-6-8-12(10-13)9-7-11;1-2/h6-10H,2-5H2,1H3;1-2H3 |
| InChIKey | VTJYTNOYERFZKR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-pentylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-pentylbenzaldehyde?
The IUPAC name of ethane;4-pentylbenzaldehyde (CID 143882863) is ethane;4-pentylbenzaldehyde.
What is the SMILES notation for ethane;4-pentylbenzaldehyde?
The canonical SMILES for ethane;4-pentylbenzaldehyde is CC.CCCCCc1ccc(C=O)cc1.
What is the InChIKey of ethane;4-pentylbenzaldehyde?
The InChIKey is VTJYTNOYERFZKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O.C2H6/c1-2-3-4-5-11-6-8-12(10-13)9-7-11;1-2/h6-10H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;4-pentylbenzaldehyde?
ethane;4-pentylbenzaldehyde has a molecular weight of 206.33 g/mol, XLogP of 4.26, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-pentylbenzaldehyde is sourced from PubChem (CID 143882863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).