About hexanoic acid;4-propylbenzaldehyde
hexanoic acid;4-propylbenzaldehyde (PubChem CID 175009771) has the molecular formula C16H24O3
and a molecular weight of 264.37 g/mol. Its IUPAC name is hexanoic acid;4-propylbenzaldehyde.
Molecular Properties
| Compound Name | hexanoic acid;4-propylbenzaldehyde |
| PubChem CID | 175009771 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | hexanoic acid;4-propylbenzaldehyde |
| SMILES | CCCCCC(=O)O.CCCc1ccc(C=O)cc1 |
| InChI | InChI=1S/C10H12O.C6H12O2/c1-2-3-9-4-6-10(8-11)7-5-9;1-2-3-4-5-6(7)8/h4-8H,2-3H2,1H3;2-5H2,1H3,(H,7,8) |
| InChIKey | KXTKMANEDQEITB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanoic acid;4-propylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoic acid;4-propylbenzaldehyde?
The IUPAC name of hexanoic acid;4-propylbenzaldehyde (CID 175009771) is hexanoic acid;4-propylbenzaldehyde.
What is the SMILES notation for hexanoic acid;4-propylbenzaldehyde?
The canonical SMILES for hexanoic acid;4-propylbenzaldehyde is CCCCCC(=O)O.CCCc1ccc(C=O)cc1.
What is the InChIKey of hexanoic acid;4-propylbenzaldehyde?
The InChIKey is KXTKMANEDQEITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C6H12O2/c1-2-3-9-4-6-10(8-11)7-5-9;1-2-3-4-5-6(7)8/h4-8H,2-3H2,1H3;2-5H2,1H3,(H,7,8).
What are the key properties of hexanoic acid;4-propylbenzaldehyde?
hexanoic acid;4-propylbenzaldehyde has a molecular weight of 264.37 g/mol, XLogP of 4.10, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoic acid;4-propylbenzaldehyde is sourced from PubChem (CID 175009771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).