About hexanoic acid;4-(2-methylpropyl)benzaldehyde
hexanoic acid;4-(2-methylpropyl)benzaldehyde (PubChem CID 175010098) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is hexanoic acid;4-(2-methylpropyl)benzaldehyde.
Molecular Properties
| Compound Name | hexanoic acid;4-(2-methylpropyl)benzaldehyde |
| PubChem CID | 175010098 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | hexanoic acid;4-(2-methylpropyl)benzaldehyde |
| SMILES | CC(C)Cc1ccc(C=O)cc1.CCCCCC(=O)O |
| InChI | InChI=1S/C11H14O.C6H12O2/c1-9(2)7-10-3-5-11(8-12)6-4-10;1-2-3-4-5-6(7)8/h3-6,8-9H,7H2,1-2H3;2-5H2,1H3,(H,7,8) |
| InChIKey | GQEYMCCXIVSKFG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanoic acid;4-(2-methylpropyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoic acid;4-(2-methylpropyl)benzaldehyde?
The IUPAC name of hexanoic acid;4-(2-methylpropyl)benzaldehyde (CID 175010098) is hexanoic acid;4-(2-methylpropyl)benzaldehyde.
What is the SMILES notation for hexanoic acid;4-(2-methylpropyl)benzaldehyde?
The canonical SMILES for hexanoic acid;4-(2-methylpropyl)benzaldehyde is CC(C)Cc1ccc(C=O)cc1.CCCCCC(=O)O.
What is the InChIKey of hexanoic acid;4-(2-methylpropyl)benzaldehyde?
The InChIKey is GQEYMCCXIVSKFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O.C6H12O2/c1-9(2)7-10-3-5-11(8-12)6-4-10;1-2-3-4-5-6(7)8/h3-6,8-9H,7H2,1-2H3;2-5H2,1H3,(H,7,8).
What are the key properties of hexanoic acid;4-(2-methylpropyl)benzaldehyde?
hexanoic acid;4-(2-methylpropyl)benzaldehyde has a molecular weight of 278.39 g/mol, XLogP of 4.35, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoic acid;4-(2-methylpropyl)benzaldehyde is sourced from PubChem (CID 175010098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).