C22H26O2 — CID 20673138
1-[4-(4-heptylphenyl)phenyl]propane-1,2-dione (PubChem CID 20673138) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[4-(4-heptylphenyl)phenyl]propane-1,2-dione.
| Compound Name | 1-[4-(4-heptylphenyl)phenyl]propane-1,2-dione |
|---|---|
| PubChem CID | 20673138 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[4-(4-heptylphenyl)phenyl]propane-1,2-dione |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(=O)C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C22H26O2/c1-3-4-5-6-7-8-18-9-11-19(12-10-18)20-13-15-21(16-14-20)22(24)17(2)23/h9-16H,3-8H2,1-2H3 |
| InChIKey | AUHFNWYRUGTFRZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|