C21H26O — CID 11369973
2,2,2-trideuterio-1-[4-(4-heptylphenyl)phenyl]ethanone (PubChem CID 11369973) has the molecular formula C21H26O and a molecular weight of 297.46 g/mol. Its IUPAC name is 2,2,2-trideuterio-1-[4-(4-heptylphenyl)phenyl]ethanone.
| Compound Name | 2,2,2-trideuterio-1-[4-(4-heptylphenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 11369973 |
| Molecular Formula | C21H26O |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 2,2,2-trideuterio-1-[4-(4-heptylphenyl)phenyl]ethanone |
| SMILES | [2H]C([2H])([2H])C(=O)c1ccc(-c2ccc(CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C21H26O/c1-3-4-5-6-7-8-18-9-11-20(12-10-18)21-15-13-19(14-16-21)17(2)22/h9-16H,3-8H2,1-2H3/i2D3 |
| InChIKey | QQQSUVSRXPLWAH-BMSJAHLVSA-N |
| XLogP | 6.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|