C19H22ClNO — CID 117066949
5-(dimethylamino)-1,1-diphenylpent-1-en-3-one;hydrochloride (PubChem CID 117066949) has the molecular formula C19H22ClNO and a molecular weight of 315.84 g/mol. Its IUPAC name is 5-(dimethylamino)-1,1-diphenylpent-1-en-3-one;hydrochloride.
| Compound Name | 5-(dimethylamino)-1,1-diphenylpent-1-en-3-one;hydrochloride |
|---|---|
| PubChem CID | 117066949 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 5-(dimethylamino)-1,1-diphenylpent-1-en-3-one;hydrochloride |
| SMILES | CN(C)CCC(=O)C=C(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H21NO.ClH/c1-20(2)14-13-18(21)15-19(16-9-5-3-6-10-16)17-11-7-4-8-12-17;/h3-12,15H,13-14H2,1-2H3;1H |
| InChIKey | PIFWZWKNAGMSPM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|