C21H16O3 — CID 5378867
(E)-2,3-bis(4-hydroxyphenyl)-1-phenylprop-2-en-1-one (PubChem CID 5378867) has the molecular formula C21H16O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (E)-2,3-bis(4-hydroxyphenyl)-1-phenylprop-2-en-1-one.
| Compound Name | (E)-2,3-bis(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 5378867 |
| Molecular Formula | C21H16O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (E)-2,3-bis(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccc(O)cc1)c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H16O3/c22-18-10-6-15(7-11-18)14-20(16-8-12-19(23)13-9-16)21(24)17-4-2-1-3-5-17/h1-14,22-23H/b20-14+ |
| InChIKey | LWNVZKQHJWTSJM-XSFVSMFZSA-N |
| XLogP | 4.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|