About actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid
actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid (PubChem CID 59099672) has the molecular formula C16H14AcO3
and a molecular weight of 481.29 g/mol. Its IUPAC name is actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid.
Molecular Properties
| Compound Name | actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid |
| PubChem CID | 59099672 |
| Molecular Formula | C16H14AcO3 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid |
| SMILES | Cc1ccc(/C=C(/C(=O)O)c2ccc(O)cc2)cc1.[Ac] |
| InChI | InChI=1S/C16H14O3.Ac/c1-11-2-4-12(5-3-11)10-15(16(18)19)13-6-8-14(17)9-7-13;/h2-10,17H,1H3,(H,18,19);/b15-10+; |
| InChIKey | HVZPHSILGFBKSP-GYVLLFFHSA-N |
| XLogP | 3.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid?
The IUPAC name of actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid (CID 59099672) is actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid.
What is the SMILES notation for actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid?
The canonical SMILES for actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid is Cc1ccc(/C=C(/C(=O)O)c2ccc(O)cc2)cc1.[Ac].
What is the InChIKey of actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid?
The InChIKey is HVZPHSILGFBKSP-GYVLLFFHSA-N. The full InChI is InChI=1S/C16H14O3.Ac/c1-11-2-4-12(5-3-11)10-15(16(18)19)13-6-8-14(17)9-7-13;/h2-10,17H,1H3,(H,18,19);/b15-10+;.
What are the key properties of actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid?
actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid has a molecular weight of 481.29 g/mol, XLogP of 3.33, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;(E)-2-(4-hydroxyphenyl)-3-(4-methylphenyl)prop-2-enoic acid is sourced from PubChem (CID 59099672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).