About 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol
4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol (PubChem CID 59197895) has the molecular formula C19H20O
and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol.
Molecular Properties
| Compound Name | 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol |
| PubChem CID | 59197895 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol |
| SMILES | C/C=C(C(=C/C)/c1ccc(O)cc1)\c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20O/c1-4-18(15-8-6-14(3)7-9-15)19(5-2)16-10-12-17(20)13-11-16/h4-13,20H,1-3H3/b18-4+,19-5+ |
| InChIKey | KEARXNCODJFQCI-MDTWDURMSA-N |
| XLogP | 5.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol?
The IUPAC name of 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol (CID 59197895) is 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol.
What is the SMILES notation for 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol?
The canonical SMILES for 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol is C/C=C(C(=C/C)/c1ccc(O)cc1)\c1ccc(C)cc1.
What is the InChIKey of 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol?
The InChIKey is KEARXNCODJFQCI-MDTWDURMSA-N. The full InChI is InChI=1S/C19H20O/c1-4-18(15-8-6-14(3)7-9-15)19(5-2)16-10-12-17(20)13-11-16/h4-13,20H,1-3H3/b18-4+,19-5+.
What are the key properties of 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol?
4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol has a molecular weight of 264.37 g/mol, XLogP of 5.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol is sourced from PubChem (CID 59197895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).