C19H20O — CID 59197895
4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol (PubChem CID 59197895) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol.
| Compound Name | 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol |
|---|---|
| PubChem CID | 59197895 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-[(2E,4E)-4-(4-methylphenyl)hexa-2,4-dien-3-yl]phenol |
| SMILES | C/C=C(C(=C/C)/c1ccc(O)cc1)\c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20O/c1-4-18(15-8-6-14(3)7-9-15)19(5-2)16-10-12-17(20)13-11-16/h4-13,20H,1-3H3/b18-4+,19-5+ |
| InChIKey | KEARXNCODJFQCI-MDTWDURMSA-N |
| XLogP | 5.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|