C36H38O4 — CID 134349907
4-[(2E,4E)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol (PubChem CID 134349907) has the molecular formula C36H38O4 and a molecular weight of 534.70 g/mol. Its IUPAC name is 4-[(2E,4E)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol.
| Compound Name | 4-[(2E,4E)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol |
|---|---|
| PubChem CID | 134349907 |
| Molecular Formula | C36H38O4 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 4-[(2E,4E)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol |
| SMILES | C/C=C(C(=C/C)/c1ccc(O)cc1)\c1ccc(O)cc1.CC/C(=C(/CC)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O2.C18H18O2/c2*1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3;3-12,19-20H,1-2H3/b18-17+;17-3+,18-4+ |
| InChIKey | QKTNCFIHWJKOLH-IJGCXSPQSA-N |
| XLogP | 9.43 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|