C23H28O — CID 142984897
ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol (PubChem CID 142984897) has the molecular formula C23H28O and a molecular weight of 320.48 g/mol. Its IUPAC name is ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol.
| Compound Name | ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol |
|---|---|
| PubChem CID | 142984897 |
| Molecular Formula | C23H28O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol |
| SMILES | C=C.C=CCCC/C(=C(\CC)c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H24O.C2H4/c1-3-5-7-12-21(18-13-15-19(22)16-14-18)20(4-2)17-10-8-6-9-11-17;1-2/h3,6,8-11,13-16,22H,1,4-5,7,12H2,2H3;1-2H2/b21-20-; |
| InChIKey | NONPCEYUQAHOHT-CFRCJOIHSA-N |
| XLogP | 6.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|