About ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol
ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol (PubChem CID 142984897) has the molecular formula C23H28O
and a molecular weight of 320.48 g/mol. Its IUPAC name is ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol.
Molecular Properties
| Compound Name | ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol |
| PubChem CID | 142984897 |
| Molecular Formula | C23H28O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol |
| SMILES | C=C.C=CCCC/C(=C(\CC)c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H24O.C2H4/c1-3-5-7-12-21(18-13-15-19(22)16-14-18)20(4-2)17-10-8-6-9-11-17;1-2/h3,6,8-11,13-16,22H,1,4-5,7,12H2,2H3;1-2H2/b21-20-; |
| InChIKey | NONPCEYUQAHOHT-CFRCJOIHSA-N |
| XLogP | 6.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol?
The IUPAC name of ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol (CID 142984897) is ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol.
What is the SMILES notation for ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol?
The canonical SMILES for ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol is C=C.C=CCCC/C(=C(\CC)c1ccccc1)c1ccc(O)cc1.
What is the InChIKey of ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol?
The InChIKey is NONPCEYUQAHOHT-CFRCJOIHSA-N. The full InChI is InChI=1S/C21H24O.C2H4/c1-3-5-7-12-21(18-13-15-19(22)16-14-18)20(4-2)17-10-8-6-9-11-17;1-2/h3,6,8-11,13-16,22H,1,4-5,7,12H2,2H3;1-2H2/b21-20-;.
What are the key properties of ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol?
ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol has a molecular weight of 320.48 g/mol, XLogP of 6.87, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;4-[(3Z)-3-phenylnona-3,8-dien-4-yl]phenol is sourced from PubChem (CID 142984897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).