acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol

C22H28O6 — CID 172835225

IUPACacetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol
SMILESCC(=O)O.CC(=O)O.CC/C(=C(/CC)c1ccc(O)cc1)c1ccc(O)cc1
InChIInChI=1S/C18H20O2.2C2H4O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14;2*1-2(3)4/h5-12,19-20H,3-4H2,1-2H3;2*1H3,(H,3,4)/b18-17+;;
InChIKeyWBDKEPPIBRXOQU-QIKYXUGXSA-N
MW388.46 g/mol
LogP5.01
Rot. Bonds4

About acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol

acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol (PubChem CID 172835225) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol.

Molecular Properties

Compound Nameacetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol
PubChem CID172835225
Molecular FormulaC22H28O6
Molecular Weight388.46 g/mol
Exact Mass388.19
IUPAC Nameacetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol
SMILESCC(=O)O.CC(=O)O.CC/C(=C(/CC)c1ccc(O)cc1)c1ccc(O)cc1
InChIInChI=1S/C18H20O2.2C2H4O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14;2*1-2(3)4/h5-12,19-20H,3-4H2,1-2H3;2*1H3,(H,3,4)/b18-17+;;
InChIKeyWBDKEPPIBRXOQU-QIKYXUGXSA-N
XLogP5.01
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500388.46
LogP ≤ 55.01
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol?
The IUPAC name of acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol (CID 172835225) is acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol.
What is the SMILES notation for acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol?
The canonical SMILES for acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol is CC(=O)O.CC(=O)O.CC/C(=C(/CC)c1ccc(O)cc1)c1ccc(O)cc1.
What is the InChIKey of acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol?
The InChIKey is WBDKEPPIBRXOQU-QIKYXUGXSA-N. The full InChI is InChI=1S/C18H20O2.2C2H4O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14;2*1-2(3)4/h5-12,19-20H,3-4H2,1-2H3;2*1H3,(H,3,4)/b18-17+;;.
What are the key properties of acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol?
acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol has a molecular weight of 388.46 g/mol, XLogP of 5.01, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol is sourced from PubChem (CID 172835225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).