C22H28O6 — CID 172835225
acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol (PubChem CID 172835225) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol.
| Compound Name | acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol |
|---|---|
| PubChem CID | 172835225 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | acetic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol |
| SMILES | CC(=O)O.CC(=O)O.CC/C(=C(/CC)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O2.2C2H4O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14;2*1-2(3)4/h5-12,19-20H,3-4H2,1-2H3;2*1H3,(H,3,4)/b18-17+;; |
| InChIKey | WBDKEPPIBRXOQU-QIKYXUGXSA-N |
| XLogP | 5.01 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|