C19H20O2 — CID 83953215
(Z)-2,3-bis(4-ethylphenyl)prop-2-enoic acid (PubChem CID 83953215) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (Z)-2,3-bis(4-ethylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2,3-bis(4-ethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83953215 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (Z)-2,3-bis(4-ethylphenyl)prop-2-enoic acid |
| SMILES | CCc1ccc(/C=C(\C(=O)O)c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C19H20O2/c1-3-14-5-7-16(8-6-14)13-18(19(20)21)17-11-9-15(4-2)10-12-17/h5-13H,3-4H2,1-2H3,(H,20,21)/b18-13- |
| InChIKey | ZWCQCSKNSUIHGN-AQTBWJFISA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|