C21H15FO — CID 5388476
(E)-3-(4-fluorophenyl)-1,2-diphenylprop-2-en-1-one (PubChem CID 5388476) has the molecular formula C21H15FO and a molecular weight of 302.35 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-1,2-diphenylprop-2-en-1-one.
| Compound Name | (E)-3-(4-fluorophenyl)-1,2-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 5388476 |
| Molecular Formula | C21H15FO |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-1,2-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccc(F)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15FO/c22-19-13-11-16(12-14-19)15-20(17-7-3-1-4-8-17)21(23)18-9-5-2-6-10-18/h1-15H/b20-15+ |
| InChIKey | JKIKWBGOHFTJEG-HMMYKYKNSA-N |
| XLogP | 5.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|