C25H23FN2O — CID 6294212
(E)-1-[4-(4-fluorophenyl)piperazin-1-yl]-2,3-diphenylprop-2-en-1-one (PubChem CID 6294212) has the molecular formula C25H23FN2O and a molecular weight of 386.47 g/mol. Its IUPAC name is (E)-1-[4-(4-fluorophenyl)piperazin-1-yl]-2,3-diphenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-fluorophenyl)piperazin-1-yl]-2,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6294212 |
| Molecular Formula | C25H23FN2O |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (E)-1-[4-(4-fluorophenyl)piperazin-1-yl]-2,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccccc1)c1ccccc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H23FN2O/c26-22-11-13-23(14-12-22)27-15-17-28(18-16-27)25(29)24(21-9-5-2-6-10-21)19-20-7-3-1-4-8-20/h1-14,19H,15-18H2/b24-19+ |
| InChIKey | TZNIQACORYPGPJ-LYBHJNIJSA-N |
| XLogP | 4.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|