C21H21NO3 — CID 92659285
(3R)-1-[(Z)-2,3-diphenylprop-2-enoyl]piperidine-3-carboxylic acid (PubChem CID 92659285) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (3R)-1-[(Z)-2,3-diphenylprop-2-enoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(Z)-2,3-diphenylprop-2-enoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 92659285 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (3R)-1-[(Z)-2,3-diphenylprop-2-enoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(C(=O)/C(=C\c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H21NO3/c23-20(22-13-7-12-18(15-22)21(24)25)19(17-10-5-2-6-11-17)14-16-8-3-1-4-9-16/h1-6,8-11,14,18H,7,12-13,15H2,(H,24,25)/b19-14-/t18-/m1/s1 |
| InChIKey | QYLWHVNLKOVGPF-GXYBQNOFSA-N |
| XLogP | 3.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|