C21H23NO2 — CID 2939984
1-(2,6-dimethylmorpholin-4-yl)-2,3-diphenylprop-2-en-1-one (PubChem CID 2939984) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-(2,6-dimethylmorpholin-4-yl)-2,3-diphenylprop-2-en-1-one.
| Compound Name | 1-(2,6-dimethylmorpholin-4-yl)-2,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 2939984 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-(2,6-dimethylmorpholin-4-yl)-2,3-diphenylprop-2-en-1-one |
| SMILES | CC1CN(C(=O)C(=Cc2ccccc2)c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C21H23NO2/c1-16-14-22(15-17(2)24-16)21(23)20(19-11-7-4-8-12-19)13-18-9-5-3-6-10-18/h3-13,16-17H,14-15H2,1-2H3 |
| InChIKey | VZIYGZNKPNNMAY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|