C22H23NO3 — CID 108754898
methyl 1-[(Z)-2,3-diphenylprop-2-enoyl]piperidine-3-carboxylate (PubChem CID 108754898) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 1-[(Z)-2,3-diphenylprop-2-enoyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[(Z)-2,3-diphenylprop-2-enoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 108754898 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | methyl 1-[(Z)-2,3-diphenylprop-2-enoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)/C(=C\c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H23NO3/c1-26-22(25)19-13-8-14-23(16-19)21(24)20(18-11-6-3-7-12-18)15-17-9-4-2-5-10-17/h2-7,9-12,15,19H,8,13-14,16H2,1H3/b20-15- |
| InChIKey | XMNFOCCEIUKUNR-HKWRFOASSA-N |
| XLogP | 3.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|