C22H25NO — CID 2938637
1-(3,5-dimethylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one (PubChem CID 2938637) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one.
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 2938637 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one |
| SMILES | CC1CC(C)CN(C(=O)C(=Cc2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H25NO/c1-17-13-18(2)16-23(15-17)22(24)21(20-11-7-4-8-12-20)14-19-9-5-3-6-10-19/h3-12,14,17-18H,13,15-16H2,1-2H3 |
| InChIKey | JOJVYEUWFFQKCZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|