C27H27NO — CID 6372372
(Z)-1-(4-benzylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one (PubChem CID 6372372) has the molecular formula C27H27NO and a molecular weight of 381.52 g/mol. Its IUPAC name is (Z)-1-(4-benzylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-1-(4-benzylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6372372 |
| Molecular Formula | C27H27NO |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (Z)-1-(4-benzylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(=C\c1ccccc1)c1ccccc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H27NO/c29-27(28-18-16-24(17-19-28)20-22-10-4-1-5-11-22)26(25-14-8-3-9-15-25)21-23-12-6-2-7-13-23/h1-15,21,24H,16-20H2/b26-21- |
| InChIKey | XHRRQZGSLIDNOW-QLYXXIJNSA-N |
| XLogP | 5.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|