C21H22ClNO2 — CID 99643485
(E)-2-(4-chlorophenyl)-1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-phenylprop-2-en-1-one (PubChem CID 99643485) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-2-(4-chlorophenyl)-1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 99643485 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-phenylprop-2-en-1-one |
| SMILES | C[C@@H]1CN(C(=O)/C(=C/c2ccccc2)c2ccc(Cl)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C21H22ClNO2/c1-15-13-23(14-16(2)25-15)21(24)20(12-17-6-4-3-5-7-17)18-8-10-19(22)11-9-18/h3-12,15-16H,13-14H2,1-2H3/b20-12+/t15-,16+ |
| InChIKey | WQYFXZAVWSDGBK-ZAYKHXHNSA-N |
| XLogP | 4.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|