C16H22N2O — CID 108903218
3,5-dimethyl-N-[(E)-2-phenylethenyl]piperidine-1-carboxamide (PubChem CID 108903218) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(E)-2-phenylethenyl]piperidine-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-[(E)-2-phenylethenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 108903218 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3,5-dimethyl-N-[(E)-2-phenylethenyl]piperidine-1-carboxamide |
| SMILES | CC1CC(C)CN(C(=O)N/C=C/c2ccccc2)C1 |
| InChI | InChI=1S/C16H22N2O/c1-13-10-14(2)12-18(11-13)16(19)17-9-8-15-6-4-3-5-7-15/h3-9,13-14H,10-12H2,1-2H3,(H,17,19)/b9-8+ |
| InChIKey | BRBJKVMXHMTYNX-CMDGGOBGSA-N |
| XLogP | 3.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |