C22H26N2O — CID 108907226
4-benzyl-N-[(E)-2-(4-methylphenyl)ethenyl]piperidine-1-carboxamide (PubChem CID 108907226) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-benzyl-N-[(E)-2-(4-methylphenyl)ethenyl]piperidine-1-carboxamide.
| Compound Name | 4-benzyl-N-[(E)-2-(4-methylphenyl)ethenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 108907226 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 4-benzyl-N-[(E)-2-(4-methylphenyl)ethenyl]piperidine-1-carboxamide |
| SMILES | Cc1ccc(/C=C/NC(=O)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O/c1-18-7-9-19(10-8-18)11-14-23-22(25)24-15-12-21(13-16-24)17-20-5-3-2-4-6-20/h2-11,14,21H,12-13,15-17H2,1H3,(H,23,25)/b14-11+ |
| InChIKey | SKYAAYZWMZHUAA-SDNWHVSQSA-N |
| XLogP | 4.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |