C15H19BrN2O2 — CID 108908691
N-[(E)-2-(4-bromophenyl)ethenyl]-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 108908691) has the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. Its IUPAC name is N-[(E)-2-(4-bromophenyl)ethenyl]-2,6-dimethylmorpholine-4-carboxamide.
| Compound Name | N-[(E)-2-(4-bromophenyl)ethenyl]-2,6-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 108908691 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[(E)-2-(4-bromophenyl)ethenyl]-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | CC1CN(C(=O)N/C=C/c2ccc(Br)cc2)CC(C)O1 |
| InChI | InChI=1S/C15H19BrN2O2/c1-11-9-18(10-12(2)20-11)15(19)17-8-7-13-3-5-14(16)6-4-13/h3-8,11-12H,9-10H2,1-2H3,(H,17,19)/b8-7+ |
| InChIKey | BGSVIMDAAGRYLT-BQYQJAHWSA-N |
| XLogP | 3.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |