C16H18FNO3 — CID 86782489
1-[(Z)-3-(4-fluorophenyl)-2-methylprop-2-enoyl]piperidine-3-carboxylic acid (PubChem CID 86782489) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is 1-[(Z)-3-(4-fluorophenyl)-2-methylprop-2-enoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(Z)-3-(4-fluorophenyl)-2-methylprop-2-enoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 86782489 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-[(Z)-3-(4-fluorophenyl)-2-methylprop-2-enoyl]piperidine-3-carboxylic acid |
| SMILES | C/C(=C/c1ccc(F)cc1)C(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C16H18FNO3/c1-11(9-12-4-6-14(17)7-5-12)15(19)18-8-2-3-13(10-18)16(20)21/h4-7,9,13H,2-3,8,10H2,1H3,(H,20,21)/b11-9- |
| InChIKey | ZXTSWOBILUFYQF-LUAWRHEFSA-N |
| XLogP | 2.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|