C14H17FN2O — CID 91943349
1-[(3R)-3-aminopyrrolidin-1-yl]-3-(4-fluorophenyl)-2-methylprop-2-en-1-one (PubChem CID 91943349) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-3-(4-fluorophenyl)-2-methylprop-2-en-1-one.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-3-(4-fluorophenyl)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 91943349 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-3-(4-fluorophenyl)-2-methylprop-2-en-1-one |
| SMILES | CC(=Cc1ccc(F)cc1)C(=O)N1CC[C@@H](N)C1 |
| InChI | InChI=1S/C14H17FN2O/c1-10(8-11-2-4-12(15)5-3-11)14(18)17-7-6-13(16)9-17/h2-5,8,13H,6-7,9,16H2,1H3/t13-/m1/s1 |
| InChIKey | LOGZRUJGUSCLPH-CYBMUJFWSA-N |
| XLogP | 1.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|