C17H21FN2O3 — CID 91943104
N-[[4-[3-(4-fluorophenyl)-2-methylprop-2-enoyl]morpholin-2-yl]methyl]acetamide (PubChem CID 91943104) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is N-[[4-[3-(4-fluorophenyl)-2-methylprop-2-enoyl]morpholin-2-yl]methyl]acetamide.
| Compound Name | N-[[4-[3-(4-fluorophenyl)-2-methylprop-2-enoyl]morpholin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 91943104 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[[4-[3-(4-fluorophenyl)-2-methylprop-2-enoyl]morpholin-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(C(=O)C(C)=Cc2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C17H21FN2O3/c1-12(9-14-3-5-15(18)6-4-14)17(22)20-7-8-23-16(11-20)10-19-13(2)21/h3-6,9,16H,7-8,10-11H2,1-2H3,(H,19,21) |
| InChIKey | JFFMSZXLLLKRKG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|