C18H25FN2O3 — CID 97218270
N-[[(2R)-4-[(2S)-4-(2-fluorophenyl)-2-methylbutanoyl]morpholin-2-yl]methyl]acetamide (PubChem CID 97218270) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is N-[[(2R)-4-[(2S)-4-(2-fluorophenyl)-2-methylbutanoyl]morpholin-2-yl]methyl]acetamide.
| Compound Name | N-[[(2R)-4-[(2S)-4-(2-fluorophenyl)-2-methylbutanoyl]morpholin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97218270 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[[(2R)-4-[(2S)-4-(2-fluorophenyl)-2-methylbutanoyl]morpholin-2-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@@H]1CN(C(=O)[C@@H](C)CCc2ccccc2F)CCO1 |
| InChI | InChI=1S/C18H25FN2O3/c1-13(7-8-15-5-3-4-6-17(15)19)18(23)21-9-10-24-16(12-21)11-20-14(2)22/h3-6,13,16H,7-12H2,1-2H3,(H,20,22)/t13-,16+/m0/s1 |
| InChIKey | UOBAJZYOTGUQGQ-XJKSGUPXSA-N |
| XLogP | 1.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |