C17H20N2O5 — CID 126781394
4-[3-[2-(acetamidomethyl)morpholin-4-yl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 126781394) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-[3-[2-(acetamidomethyl)morpholin-4-yl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[3-[2-(acetamidomethyl)morpholin-4-yl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 126781394 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-[3-[2-(acetamidomethyl)morpholin-4-yl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | CC(=O)NCC1CN(C(=O)C=Cc2ccc(C(=O)O)cc2)CCO1 |
| InChI | InChI=1S/C17H20N2O5/c1-12(20)18-10-15-11-19(8-9-24-15)16(21)7-4-13-2-5-14(6-3-13)17(22)23/h2-7,15H,8-11H2,1H3,(H,18,20)(H,22,23) |
| InChIKey | YRDDLTBFMLXDPP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|