C16H19NO4S — CID 119174108
(3S)-1-(2-phenacylsulfanylacetyl)piperidine-3-carboxylic acid (PubChem CID 119174108) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is (3S)-1-(2-phenacylsulfanylacetyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2-phenacylsulfanylacetyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119174108 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (3S)-1-(2-phenacylsulfanylacetyl)piperidine-3-carboxylic acid |
| SMILES | O=C(CSCC(=O)N1CCC[C@H](C(=O)O)C1)c1ccccc1 |
| InChI | InChI=1S/C16H19NO4S/c18-14(12-5-2-1-3-6-12)10-22-11-15(19)17-8-4-7-13(9-17)16(20)21/h1-3,5-6,13H,4,7-11H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | NKJZTYYUTAAROP-ZDUSSCGKSA-N |
| XLogP | 1.93 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |