C17H13ClO2 — CID 5388570
(2Z)-2-[(3-chlorophenyl)methylidene]-1-phenylbutane-1,3-dione (PubChem CID 5388570) has the molecular formula C17H13ClO2 and a molecular weight of 284.74 g/mol. Its IUPAC name is (2Z)-2-[(3-chlorophenyl)methylidene]-1-phenylbutane-1,3-dione.
| Compound Name | (2Z)-2-[(3-chlorophenyl)methylidene]-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 5388570 |
| Molecular Formula | C17H13ClO2 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (2Z)-2-[(3-chlorophenyl)methylidene]-1-phenylbutane-1,3-dione |
| SMILES | CC(=O)/C(=C/c1cccc(Cl)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H13ClO2/c1-12(19)16(11-13-6-5-9-15(18)10-13)17(20)14-7-3-2-4-8-14/h2-11H,1H3/b16-11- |
| InChIKey | FDWALFOBCKXYPC-WJDWOHSUSA-N |
| XLogP | 4.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|