C17H10BrF3O2 — CID 126363906
(2Z)-2-benzylidene-1-(4-bromophenyl)-4,4,4-trifluorobutane-1,3-dione (PubChem CID 126363906) has the molecular formula C17H10BrF3O2 and a molecular weight of 383.16 g/mol. Its IUPAC name is (2Z)-2-benzylidene-1-(4-bromophenyl)-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | (2Z)-2-benzylidene-1-(4-bromophenyl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 126363906 |
| Molecular Formula | C17H10BrF3O2 |
| Molecular Weight | 383.16 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | (2Z)-2-benzylidene-1-(4-bromophenyl)-4,4,4-trifluorobutane-1,3-dione |
| SMILES | O=C(/C(=C/c1ccccc1)C(=O)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H10BrF3O2/c18-13-8-6-12(7-9-13)15(22)14(16(23)17(19,20)21)10-11-4-2-1-3-5-11/h1-10H/b14-10- |
| InChIKey | MDTHXFCZWQUWQH-UVTDQMKNSA-N |
| XLogP | 4.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.16 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|