C17H12Br2O — CID 2046768
(2E,4Z)-4-bromo-1-(4-bromophenyl)-5-phenylpenta-2,4-dien-1-one (PubChem CID 2046768) has the molecular formula C17H12Br2O and a molecular weight of 392.09 g/mol. Its IUPAC name is (2E,4Z)-4-bromo-1-(4-bromophenyl)-5-phenylpenta-2,4-dien-1-one.
| Compound Name | (2E,4Z)-4-bromo-1-(4-bromophenyl)-5-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 2046768 |
| Molecular Formula | C17H12Br2O |
| Molecular Weight | 392.09 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | (2E,4Z)-4-bromo-1-(4-bromophenyl)-5-phenylpenta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C(Br)=C/c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H12Br2O/c18-15-8-6-14(7-9-15)17(20)11-10-16(19)12-13-4-2-1-3-5-13/h1-12H/b11-10+,16-12- |
| InChIKey | ZGEXJMLQCXGASW-ZBUTWXCBSA-N |
| XLogP | 5.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.09 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|