C16H9Br2F3O — CID 122402631
(E)-3-(3,5-dibromophenyl)-1-phenyl-2-(trifluoromethyl)prop-2-en-1-one (PubChem CID 122402631) has the molecular formula C16H9Br2F3O and a molecular weight of 434.05 g/mol. Its IUPAC name is (E)-3-(3,5-dibromophenyl)-1-phenyl-2-(trifluoromethyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dibromophenyl)-1-phenyl-2-(trifluoromethyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122402631 |
| Molecular Formula | C16H9Br2F3O |
| Molecular Weight | 434.05 g/mol |
| Exact Mass | 431.90 |
| IUPAC Name | (E)-3-(3,5-dibromophenyl)-1-phenyl-2-(trifluoromethyl)prop-2-en-1-one |
| SMILES | O=C(/C(=C\c1cc(Br)cc(Br)c1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H9Br2F3O/c17-12-6-10(7-13(18)9-12)8-14(16(19,20)21)15(22)11-4-2-1-3-5-11/h1-9H/b14-8+ |
| InChIKey | IZJFHOWBPMGLSE-RIYZIHGNSA-N |
| XLogP | 6.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.05 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|