C16H10BrF3O — CID 71421957
2-(4-bromophenyl)-4,4,4-trifluoro-1-phenylbut-2-en-1-one (PubChem CID 71421957) has the molecular formula C16H10BrF3O and a molecular weight of 355.15 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4,4,4-trifluoro-1-phenylbut-2-en-1-one.
| Compound Name | 2-(4-bromophenyl)-4,4,4-trifluoro-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 71421957 |
| Molecular Formula | C16H10BrF3O |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 2-(4-bromophenyl)-4,4,4-trifluoro-1-phenylbut-2-en-1-one |
| SMILES | O=C(C(=CC(F)(F)F)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H10BrF3O/c17-13-8-6-11(7-9-13)14(10-16(18,19)20)15(21)12-4-2-1-3-5-12/h1-10H |
| InChIKey | ZNSDKPZBRCAKKJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|