C16H10BrF2IO — CID 132822012
(E)-1-(4-bromophenyl)-2,2-difluoro-4-iodo-4-phenylbut-3-en-1-one (PubChem CID 132822012) has the molecular formula C16H10BrF2IO and a molecular weight of 463.06 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-2,2-difluoro-4-iodo-4-phenylbut-3-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-2,2-difluoro-4-iodo-4-phenylbut-3-en-1-one |
|---|---|
| PubChem CID | 132822012 |
| Molecular Formula | C16H10BrF2IO |
| Molecular Weight | 463.06 g/mol |
| Exact Mass | 461.89 |
| IUPAC Name | (E)-1-(4-bromophenyl)-2,2-difluoro-4-iodo-4-phenylbut-3-en-1-one |
| SMILES | O=C(c1ccc(Br)cc1)C(F)(F)/C=C(/I)c1ccccc1 |
| InChI | InChI=1S/C16H10BrF2IO/c17-13-8-6-12(7-9-13)15(21)16(18,19)10-14(20)11-4-2-1-3-5-11/h1-10H/b14-10+ |
| InChIKey | AZDBEEWRKYTCIF-GXDHUFHOSA-N |
| XLogP | 5.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.06 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|