C18H13F2NOS — CID 171784635
[(E)-3,3-difluoro-1-(4-methylphenyl)-4-oxo-4-phenylbut-1-enyl] thiocyanate (PubChem CID 171784635) has the molecular formula C18H13F2NOS and a molecular weight of 329.37 g/mol. Its IUPAC name is [(E)-3,3-difluoro-1-(4-methylphenyl)-4-oxo-4-phenylbut-1-enyl] thiocyanate.
| Compound Name | [(E)-3,3-difluoro-1-(4-methylphenyl)-4-oxo-4-phenylbut-1-enyl] thiocyanate |
|---|---|
| PubChem CID | 171784635 |
| Molecular Formula | C18H13F2NOS |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | [(E)-3,3-difluoro-1-(4-methylphenyl)-4-oxo-4-phenylbut-1-enyl] thiocyanate |
| SMILES | Cc1ccc(/C(=C\C(F)(F)C(=O)c2ccccc2)SC#N)cc1 |
| InChI | InChI=1S/C18H13F2NOS/c1-13-7-9-14(10-8-13)16(23-12-21)11-18(19,20)17(22)15-5-3-2-4-6-15/h2-11H,1H3/b16-11+ |
| InChIKey | HWNMYUHMEHHLLU-LFIBNONCSA-N |
| XLogP | 5.07 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|