C10H7F2NO — CID 102048810
2,2-difluoro-3-(4-methylphenyl)-3-oxopropanenitrile (PubChem CID 102048810) has the molecular formula C10H7F2NO and a molecular weight of 195.17 g/mol. Its IUPAC name is 2,2-difluoro-3-(4-methylphenyl)-3-oxopropanenitrile.
| Compound Name | 2,2-difluoro-3-(4-methylphenyl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 102048810 |
| Molecular Formula | C10H7F2NO |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2,2-difluoro-3-(4-methylphenyl)-3-oxopropanenitrile |
| SMILES | Cc1ccc(C(=O)C(F)(F)C#N)cc1 |
| InChI | InChI=1S/C10H7F2NO/c1-7-2-4-8(5-3-7)9(14)10(11,12)6-13/h2-5H,1H3 |
| InChIKey | BOOJSJPLALSSHX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |