C9H9F2O+ — CID 131857858
2,2-difluoro-1-(4-methylphenyl)ethanone;hydron (PubChem CID 131857858) has the molecular formula C9H9F2O+ and a molecular weight of 171.17 g/mol. Its IUPAC name is 2,2-difluoro-1-(4-methylphenyl)ethanone;hydron.
| Compound Name | 2,2-difluoro-1-(4-methylphenyl)ethanone;hydron |
|---|---|
| PubChem CID | 131857858 |
| Molecular Formula | C9H9F2O+ |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 2,2-difluoro-1-(4-methylphenyl)ethanone;hydron |
| SMILES | Cc1ccc(C(=O)C(F)F)cc1.[H+] |
| InChI | InChI=1S/C9H8F2O/c1-6-2-4-7(5-3-6)8(12)9(10)11/h2-5,9H,1H3/p+1 |
| InChIKey | RKOAJRSRPAQUFF-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |