C10H10F2O — CID 91636254
1-(3,5-dimethylphenyl)-2,2-difluoroethanone (PubChem CID 91636254) has the molecular formula C10H10F2O and a molecular weight of 184.18 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2,2-difluoroethanone.
| Compound Name | 1-(3,5-dimethylphenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 91636254 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2,2-difluoroethanone |
| SMILES | Cc1cc(C)cc(C(=O)C(F)F)c1 |
| InChI | InChI=1S/C10H10F2O/c1-6-3-7(2)5-8(4-6)9(13)10(11)12/h3-5,10H,1-2H3 |
| InChIKey | CZIJSTNHPCYFDG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |